Systematic / IUPAC Name: Terephthalic acid
ID: Reference1499
Other Names:
p-Benzenedicarboxylic acid;
Benzene-1,4-dicarboxylic acid;
Benzene-p-dicarboxylic acid;
p-Benzenedicarboxylate;
p-Carboxybenzoic acid
Formula: C8H6O4
Class: Industrial Chemicals
Terephthalic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 53 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 9:44:32 AM |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
| InChI Key | KKEYFWRCBNTPAC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C(=O)O)C(=O)O |
| CAS | 100210 |
| Splash | |
| Other Names |
p-Benzenedicarboxylic acid; Benzene-1,4-dicarboxylic acid; Benzene-p-dicarboxylic acid; p-Benzenedicarboxylate; p-Carboxybenzoic acid; 4-Carboxybenzoic acid |