Systematic / IUPAC Name: 2-Hydroxypentanoic acid
ID: Reference150
Other Names:
Pentanoic acid, 2-hydroxy-;
α-Hydroxyvaleric acid;
α-Hydroxy-n-valeric acid
Formula: C5H10O3
Class: Endogenous Metabolites
2-Hydroxyvaleric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/10/2014 10:11:49 AM |
| InChI | InChI=1S/C5H10O3/c1-2-3-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8) |
| InChI Key | JRHWHSJDIILJAT-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(C(=O)O)O |
| CAS | 617312 |
| Splash | |
| Other Names |
Pentanoic acid, 2-hydroxy-; α-Hydroxyvaleric acid; α-Hydroxy-n-valeric acid |
| ChEBI | CHEBI:60647 |
| PubChem | 98009 |
| ChemSpider | 88482 |
| LipidsMAPs | LMFA01050007 |
| ChemIDPlus | 000617312; 006450971; 041014931 |