Systematic / IUPAC Name: 1-O-Phosphono-α-D-ribofuranose
ID: Reference1506
Other Names:
D-Ribofuranose 1-phosphate;
Ribose 1-phosphic acid;
α-D-Ribofuranose 1-phosphate;
1-Phospho-α-D-ribofuranose
Formula: C5H11O8P
Class: Endogenous Metabolites
D-Ribose-1-phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 8:21:35 AM |
| InChI | InChI=1S/C5H11O8P/c6-1-2-3(7)4(8)5(12-2)13-14(9,10)11/h2-8H,1H2,(H2,9,10,11)/t2-,3-,4-,5-/m1/s1 |
| InChI Key | YXJDFQJKERBOBM-TXICZTDVSA-N |
| Canonical SMILES | C(C1C(C(C(O1)OP(=O)(O)O)O)O)O |
| CAS | 14075004 |
| Splash | |
| Other Names |
D-Ribofuranose 1-phosphate; Ribose 1-phosphic acid; α-D-Ribofuranose 1-phosphate; 1-Phospho-α-D-ribofuranose |
| KEGG | C00620 |
| PubChem | 439236 |
| ChEMBL | CHEMBL603367 |
| ChemSpider | 388373 |
| HMDb | HMDB01489 |
| ChEBI | CHEBI:16300 |