Systematic / IUPAC Name: 2-Aminoethyl diphenylborinate
ID: Reference1507
Other Names:
o-(2-Aminoethyl)diphenylborinic acid;
2-Aminoethyl diphenyl borate;
Borinic acid, o-(2-aminoethyl)diphenyl-;
(2-Aminoethoxy)(diphenyl)borane;
Diphenylboric acid 2-aminoethyl ester
Formula: C14H16BNO
2-Aminoethyl diphenylborinate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 56 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 8:14:42 AM |
| InChI | InChI=1S/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| InChI Key | BLZVCIGGICSWIG-UHFFFAOYSA-N |
| Canonical SMILES | B(C1=CC=CC=C1)(C2=CC=CC=C2)OCCN |
| CAS | 524958 |
| Splash | |
| Other Names |
o-(2-Aminoethyl)diphenylborinic acid; 2-Aminoethyl diphenyl borate; Borinic acid, o-(2-aminoethyl)diphenyl-; (2-Aminoethoxy)(diphenyl)borane; Diphenylboric acid 2-aminoethyl ester; 2-Diphenylboranyloxyethanamine |
| ChemIDPlus | 000524958 |
| PubChem | 1598 |
| ChemSpider | 1540 |
| ChEMBL | CHEMBL169233 |
| KEGG | C20698 |
| Wikipedia | 2-Aminoethoxydiphenyl borate |