Systematic / IUPAC Name: Butoxyacetic acid
ID: Reference1513
Other Names:
2-Butoxyacetic acid;
n-Butoxyacetic acid;
Acetic acid, 2-butoxy-
Formula: C6H12O3
2-Butoxyacetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 8:02:12 AM |
| InChI | InChI=1S/C6H12O3/c1-2-3-4-9-5-6(7)8/h2-5H2,1H3,(H,7,8) |
| InChI Key | AJQOASGWDCBKCJ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOCC(=O)O |
| CAS | 2516930 |
| Splash | |
| Other Names |
2-Butoxyacetic acid; n-Butoxyacetic acid; Acetic acid, 2-butoxy- |