Systematic / IUPAC Name: 4-Hydroxyphenyl β-D-glucopyranoside
ID: Reference1518
Other Names:
p-Hydroxyphenyl β-D-glucoside;
p-Hydroxyphenyl β-D-glucopyranoside;
β-D-Glucopyranoside, 4-hydroxyphenyl;
(2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol;
Ursin
; more
Formula: C12H16O7
Class: Endogenous Metabolites
Arbutin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2014 7:48:35 AM |
| InChI | InChI=1S/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChI Key | BJRNKVDFDLYUGJ-RMPHRYRLSA-N |
| Canonical SMILES | C1=CC(=CC=C1O)OC2C(C(C(C(O2)CO)O)O)O |
| CAS | 497767 |
| Splash | |
| Other Names |
p-Hydroxyphenyl β-D-glucoside; p-Hydroxyphenyl β-D-glucopyranoside; β-D-Glucopyranoside, 4-hydroxyphenyl; (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol; Ursin; Uvasol; Arbutoside; β-Arbutin; Hydroquinone-O-β-D-glucopyranoside |
| Wikipedia | Arbutin |
| ChemSpider | 389765 |
| PubChem | 440936 |
| ChEMBL | CHEMBL232202 |
| ChEBI | CHEBI:18305 |
| KEGG | C06186 |