Systematic / IUPAC Name: 5'-Guanylic acid
ID: Reference1519
Other Names:
Guanidine monophosphate;
Guanosinephosphate;
GMP;
Guanine riboside-5-phosphoric acid
Formula: C10H14N5O8P
Class: Endogenous Metabolites
Guanosine monophosphate (GMP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1732 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 9/26/2025 5:22:03 PM |
| InChI | InChI=1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1 |
| InChI Key | RQFCJASXJCIDSX-UUOKFMHZSA-N |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)O)O)O)NC(=NC2=O)N |
| CAS | 85325 |
| Splash | |
| Other Names |
Guanidine monophosphate; Guanosinephosphate; GMP; Guanine riboside-5-phosphoric acid |
| HMDb | HMDB01397 |
| ChEMBL | CHEMBL283807 |
| ChEBI | CHEBI:17345 |
| ChemSpider | 6545 |
| PubChem | 6804 |
| KEGG | C00144 |
| ChemIDPlus | 000085325; 005550129; 025191144; 029593020 |
| Wikipedia | Guanosine monophosphate |