Systematic / IUPAC Name: 6-O-Phosphono-α-D-mannopyranose
ID: Reference1528
Other Names: α-D-Mannose-6-phosphate
Formula: C6H13O9P
Class: Endogenous Metabolites
D-Mannose 6-phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 167 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 3:04:49 PM |
| InChI | InChI=1S/C6H13O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6+/m1/s1 |
| InChI Key | NBSCHQHZLSJFNQ-PQMKYFCFSA-N |
| Canonical SMILES | C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O |
| CAS | 3672159 |
| Splash | |
| Other Names | α-D-Mannose-6-phosphate |
| PubChem | 447096 |
| ChEMBL | CHEMBL402001 |
| ChEBI | CHEBI:43896 |
| ChemSpider | 394282 |
| Wikipedia | Mannose_6-phosphate |