Systematic / IUPAC Name: (2S)-2-Aminobutanoic acid
ID: Reference1539
Other Names:
L-α-Aminobutyric acid;
(S)-2-Aminobutanoic acid;
(S)-(+)-2-Aminobutyric acid;
(S)-2-Aminobutanoate;
L-α-Aminobutyrate
; more
Formula: C4H9NO2
Class: Endogenous Metabolites
L(+)-2-Aminobutyric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 123 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/16/2016 10:48:24 AM |
| InChI | InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChI Key | QWCKQJZIFLGMSD-VKHMYHEASA-N |
| Canonical SMILES | CCC(C(=O)O)N |
| CAS | 1492246 |
| Splash | |
| Other Names |
L-α-Aminobutyric acid; (S)-2-Aminobutanoic acid; (S)-(+)-2-Aminobutyric acid; (S)-2-Aminobutanoate; L-α-Aminobutyrate; α-Aminobutyric acid; L-Ethylglycine; Butanoic acid, 2-amino-, (2S)-; L-Aminobutyric acid; (+)-2-Aminobutanoate |
| KEGG | C02356 |
| ChEBI | CHEBI:35619; CHEBI:74359 |
| PubChem | 80283 |
| ChEMBL | CHEMBL1230782 |
| HMDb | HMDB00452; HMDB61050 |
| ChemSpider | 72524 |
| ChemIDPlus | 001492246 |