Systematic / IUPAC Name: (2S)-2-Amino-4-methylsulfanylbutanoic acid
ID: Reference1544
Other Names:
L-α-Amino-Υ-methylmercaptobutyric acid;
L(-)-Amino-Υ-methylthiobutyric acid;
L-Υ-Methylthio-α-aminobutyric acid;
2-Amino-4-methylthiobutanoic acid (S)-;
S-Methyl-L-homocysteine
; more
Formula: C5H11NO2S
Class: Endogenous Metabolites
L-(-)-Methionine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 699 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 2/11/2015 9:23:52 AM |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChI Key | FFEARJCKVFRZRR-BYPYZUCNSA-N |
| Canonical SMILES | CSCCC(C(=O)O)N |
| CAS | 63683 |
| Splash | |
| Other Names |
L-α-Amino-Υ-methylmercaptobutyric acid; L(-)-Amino-Υ-methylthiobutyric acid; L-Υ-Methylthio-α-aminobutyric acid; 2-Amino-4-methylthiobutanoic acid (S)-; S-Methyl-L-homocysteine; Butanoic acid, 2-amino-4-(methylthio)-, (S)-; Υ-Methylthio-α-aminobutyric acid; L-2-Amino-4-(methylthio)butanoic acid; (S)-2-Amino-4-(methylmercapto)butyric acid; L-2-Amino-4-(methylthio)butyric acid; 2-Amino-4-methylthiobutanoic acid; α-Amino-α-aminobutyric acid; L(-)-Amino-α-amino-α-aminobutyric acid; Cymethion; Methilanin; Neo-methidin; (S)-Methionine; Methionine, L- |
| KEGG | C00073; D00019 |
| ChEMBL | CHEMBL42336 |
| Wikipedia | Methionine |
| ChEBI | CHEBI:16643; CHEBI:57844 |
| PubChem | 6137 |
| ChemSpider | 5907 |
| ChemIDPlus | 000063683 |
| HMDb | HMDB00696 |