Systematic / IUPAC Name: Nonafluoropentanoic acid
ID: Reference1567
Other Names:
Perfluorovaleric acid;
Nonafluorovaleric acid;
Pentanoic acid, nonafluoro-;
Perfluoro-n-pentanoic acid;
Valeric acid, nonafluoro-
; more
Formula: C5HF9O2
Class: Extractables/Leachables Perfluorinated Hydrocarbons
Perfluoropentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap Fusion; Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 4 |
| No. of Spectra | 579 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/21/2023 4:28:28 PM |
| InChI | InChI=1S/C5HF9O2/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14/h(H,15,16) |
| InChI Key | CXZGQIAOTKWCDB-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 2706903 |
| Splash | |
| Other Names |
Perfluorovaleric acid; Nonafluorovaleric acid; Pentanoic acid, nonafluoro-; Perfluoro-n-pentanoic acid; Valeric acid, nonafluoro-; Nonafluoro-1-pentanoic acid; 2,2,3,3,4,4,5,5,5-Nonafluoropentanoic acid |
| ChemSpider | 68426 |
| ChemIDPlus | 002706890; 002706903 |
| ChEMBL | CHEMBL173263 |
| PubChem | 75921 |