Systematic / IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptanoic acid
ID: Reference1569
Other Names:
Tridecafluoroheptanoic acid;
Heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-;
Heptanoic acid, tridecafluoro-
Formula: C7HF13O2
Class: Extractables/Leachables Perfluorinated Hydrocarbons
Perfluoroheptanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap Fusion; Orbitrap Fusion with FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 707 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/27/2018 8:37:15 AM |
| InChI | InChI=1S/C7HF13O2/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h(H,21,22) |
| InChI Key | ZWBAMYVPMDSJGQ-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 375859 |
| Splash | |
| Other Names |
Tridecafluoroheptanoic acid; Heptanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-; Heptanoic acid, tridecafluoro- |
| PubChem | 67818 |
| ChEMBL | CHEMBL172763 |
| ChemIDPlus | 000375859; 020109595 |
| ChemSpider | 61135 |
| ChEBI | CHEBI:35547 |