Systematic / IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctanoic acid
ID: Reference1570
Other Names:
Pentadecafluorooctanoic acid;
Perfluorocaprylic acid;
Octanoic acid, pentadecafluoro-;
Perfluoroheptanecarboxylic acid;
Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-
Formula: C8HF15O2
Class: Extractables/Leachables Industrial Chemicals Perfluorinated Hydrocarbons
Perfluorooctanoic acid (PFOA) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap Fusion with FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 390 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 9/26/2019 7:07:08 AM |
| InChI | InChI=1S/C8HF15O2/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h(H,24,25) |
| InChI Key | SNGREZUHAYWORS-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 335671 |
| Splash | |
| Other Names |
Pentadecafluorooctanoic acid; Perfluorocaprylic acid; Octanoic acid, pentadecafluoro-; Perfluoroheptanecarboxylic acid; Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-; Hexanoyl fluoride, 3,3,4,4,5,5,6,6,6-nonafluoro-2-oxo- |
| ChemIDPlus | 000335671; 000335955; 000335933; 068141026 |
| ChEBI | CHEBI:35549 |
| ChemSpider | 9180 |
| HMDb | HMDB59587 |
| ChEMBL | CHEMBL172988 |
| PubChem | 9554 |
| Wikipedia | Perfluorooctanoic acid |