Systematic / IUPAC Name: 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Heptadecafluorooctylsulfonylamino)acetic acid
ID: Reference1572
Other Names: Glycine, N-[(heptadecafluorooctyl)sulfonyl]-
Formula: C10H4F17NO4S
Class: Perfluorinated Hydrocarbons
N-[(Heptadecafluorooctyl)sulfonyl]-glycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 14 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 10:51:46 AM |
| InChI | InChI=1S/C10H4F17NO4S/c11-3(12,5(15,16)7(19,20)9(23,24)25)4(13,14)6(17,18)8(21,22)10(26,27)33(31,32)28-1-2(29)30/h28H,1H2,(H,29,30) |
| InChI Key | AYLOUUCBACYHAB-UHFFFAOYSA-N |
| Canonical SMILES | C(C(=O)O)NS(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| CAS | 2806248 |
| Splash | |
| Other Names | Glycine, N-[(heptadecafluorooctyl)sulfonyl]- |