Systematic / IUPAC Name:
ID: Reference1589
Other Names:
Formula: C19H16O3
Class: Pesticides/Herbicides
Coumatetralyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 86 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/12/2015 12:57:24 PM |
| InChI | InChI=1S/C19H16O3/c20-18-15-7-3-4-8-16(15)22-19(21)17(18)14-10-9-12-5-1-2-6-13(12)11-14/h1-8,14,20H,9-11H2 |
| InChI Key | YNFKVAPNXKISEQ-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |