Systematic / IUPAC Name: 1,7-Dimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione
ID: Reference16
Other Names:
1,7-Dimethyl-2,6,8-trihydroxypurine;
1,7-Dimethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione
Formula: C7H8N4O3
Class: Endogenous Metabolites
1,7-Dimethyluric acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 988 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/15/2015 9:38:03 AM |
| InChI | InChI=1S/C7H8N4O3/c1-10-3-4(8-6(10)13)9-7(14)11(2)5(3)12/h1-2H3,(H,8,13)(H,9,14) |
| InChI Key | NOFNCLGCUJJPKU-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2=C(NC1=O)NC(=O)N(C2=O)C |
| CAS | 33868030 |
| Splash | |
| Other Names |
1,7-Dimethyl-2,6,8-trihydroxypurine; 1,7-Dimethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione |
| ChEBI | CHEBI:68449 |
| PubChem | 91611 |
| ChEMBL | CHEMBL794 |
| ChemIDPlus | 033868030 |
| ChemSpider | 82720 |