Systematic / IUPAC Name: 2,2-Dichloro-N-{(1R,2S)-3-fluoro-1-hydroxy-1-[4-(methylsulfonyl)phenyl]-2-propanyl}acetamide
ID: Reference1620
Other Names:
(-)-Florfenicol;
Aquafen;
Nuflor;
[R-(R*,S*)]-2,2-Dichloro-N-{1-(fluoromethyl)-2-hydroxy-2-[4-(methylsulfonyl)phenyl]ethyl}acetamide ;
Acetamide, 2,2-dichloro-N-(1-(fluoromethyl)-2-hydroxy-2-(4-(methylsulfonyl)phenyl)ethyl), [R-(R*,S*)]-
Formula: C12H14Cl2FNO4S
Class: Pesticides/Herbicides
Florfenicol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 1928 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/25/2016 1:26:45 PM |
| InChI | InChI=1S/C12H14Cl2FNO4S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-15)16-12(18)11(13)14/h2-5,9-11,17H,6H2,1H3,(H,16,18)/t9-,10-/m1/s1 |
| InChI Key | AYIRNRDRBQJXIF-NXEZZACHSA-N |
| Canonical SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(CF)NC(=O)C(Cl)Cl)O |
| CAS | 73231342 |
| Splash | |
| Other Names |
(-)-Florfenicol; Aquafen; Nuflor; [R-(R*,S*)]-2,2-Dichloro-N-{1-(fluoromethyl)-2-hydroxy-2-[4-(methylsulfonyl)phenyl]ethyl}acetamide ; Acetamide, 2,2-dichloro-N-(1-(fluoromethyl)-2-hydroxy-2-(4-(methylsulfonyl)phenyl)ethyl), [R-(R*,S*)]- ; Benzenesulfonic acid, 4-{2-[(dichloroacetyl)amino]-3-fluoro-1-hydroxypropyl}, methyl ester, [R-(R*,S*)]- |
| ChemIDPlus | 073231342 |
| KEGG | D04194 |
| ChEMBL | CHEMBL1241590 |
| ChemSpider | 4372750 |
| PubChem | 114811 |
| Wikipedia | Florfenicol |