Systematic / IUPAC Name: N-({4-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl}carbamoyl)-2,6-difluorobenzamide
ID: Reference1625
Other Names:
Cascade;
N-({4-[2-Chloranyl-4-(trifluoromethyl)phenoxy]-2-fluoranyl-phenyl}carbamoyl)-2,6-bis(fluoranyl)benzamide ;
N-({4-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-fluoroanilino}-oxomethyl)-2,6-difluorobenzamide ;
Benzamide, N-[({4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl}amino)carbonyl]-2,6-difluoro-
Formula: C21H11ClF6N2O3
Class: Pesticides/Herbicides
Flufenoxuron mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 4310 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 10/25/2016 1:40:42 PM |
| InChI | InChI=1S/C21H11ClF6N2O3/c22-12-8-10(21(26,27)28)4-7-17(12)33-11-5-6-16(15(25)9-11)29-20(32)30-19(31)18-13(23)2-1-3-14(18)24/h1-9H,(H2,29,30,31,32) |
| InChI Key | RYLHNOVXKPXDIP-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=C(C=C(C=C2)OC3=C(C=C(C=C3)C(F)(F)F)Cl)F)F |
| CAS | 101463698 |
| Splash | |
| Other Names |
Cascade; N-({4-[2-Chloranyl-4-(trifluoromethyl)phenoxy]-2-fluoranyl-phenyl}carbamoyl)-2,6-bis(fluoranyl)benzamide ; N-({4-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-fluoroanilino}-oxomethyl)-2,6-difluorobenzamide ; Benzamide, N-[({4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-fluorophenyl}amino)carbonyl]-2,6-difluoro- |
| PubChem | 91766 |
| ChemSpider | 82863 |
| ChEMBL | CHEMBL2287680 |
| ChEBI | CHEBI:39382 |
| KEGG | C18430 |
| ChemIDPlus | 101463698 |