Systematic / IUPAC Name: Tetradecanedioic acid
ID: Reference1652
Other Names:
1,12-Dodecanedicarboxylic acid;
Tetradecane-1,14-dioic acid;
1,14-Tetradecanedioic acid;
Dodecanedicarboxylic acid;
Dodecamethylenedicarboxylic acid
Formula: C14H26O4
Class: Endogenous Metabolites
Tetradecanedioic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 3003 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 2/12/2015 10:07:54 AM |
| InChI | InChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18) |
| InChI Key | HQHCYKULIHKCEB-UHFFFAOYSA-N |
| Canonical SMILES | C(CCCCCCC(=O)O)CCCCCC(=O)O |
| CAS | 821385 |
| Splash | |
| Other Names |
1,12-Dodecanedicarboxylic acid; Tetradecane-1,14-dioic acid; 1,14-Tetradecanedioic acid; Dodecanedicarboxylic acid; Dodecamethylenedicarboxylic acid; Tetradecanedicarboxylic acid |
| LipidsMAPs | LMFA01170018 |
| HMDb | HMDB00872 |
| ChemIDPlus | 000821385 |
| PubChem | 13185 |
| ChemSpider | 12630 |
| ChEBI | CHEBI:76308 |