Systematic / IUPAC Name: 4-(1,2-Dihydroxyethyl)-2-methoxyphenyl hydrogen sulfate
ID: Reference1686
Other Names:
MOPEG sulfate;
3-Methoxy-4-hydroxyphenylethyleneglycol sulfate;
1,2-Ethanediol, 1-[3-methoxy-4-(sulfooxy)phenyl]-;
3-Methoxy-4-hydroxyphenylglycol 4-sulfate;
(3-Methoxy-4-hydroxyphenyl)glycol O-sulfate
; more
Formula: C9H12O7S
Class: Endogenous Metabolites
4-Hydroxy-3- methoxyphenylglycol sulfate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 216 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/12/2015 3:48:00 PM |
| InChI | InChI=1S/C9H12O7S/c1-15-9-4-6(7(11)5-10)2-3-8(9)16-17(12,13)14/h2-4,7,10-11H,5H2,1H3,(H,12,13,14) |
| InChI Key | WUFPNASKMLJSND-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=CC(=C1)C(CO)O)OS(=O)(=O)O |
| CAS | 3415676 |
| Splash | |
| Other Names |
MOPEG sulfate; 3-Methoxy-4-hydroxyphenylethyleneglycol sulfate; 1,2-Ethanediol, 1-[3-methoxy-4-(sulfooxy)phenyl]-; 3-Methoxy-4-hydroxyphenylglycol 4-sulfate; (3-Methoxy-4-hydroxyphenyl)glycol O-sulfate; (3-Methoxy-4-hydroxyphenyl)glycol sulfate ester; (3-Methoxy-4-hydroxyphenyl)ethylene glycol sulfate; 3-Methoxy-4-hydroxyphenylethyleneglycol sulfic acid |
| ChemIDPlus | 003415676 |
| ChemSpider | 4039 |
| PubChem | 4183 |
| ChEMBL | CHEMBL1567131 |
| HMDb | HMDB00559 |