Systematic / IUPAC Name: 1,6-Di-O-phosphono-α-D-glucopyranose
ID: Reference1711
Other Names:
Glucose-1,6-bisphosphate;
D-Glucose 1,6-bisphosphate;
Glucose 1,6-diphosphate;
α-Glucose 1,6-diphosphate
Formula: C6H14O12P2
Class: Endogenous Metabolites
α-D-Glucose-1,6-bisphosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 207 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/13/2017 10:44:49 AM |
| InChI | InChI=1S/C6H14O12P2/c7-3-2(1-16-19(10,11)12)17-6(5(9)4(3)8)18-20(13,14)15/h2-9H,1H2,(H2,10,11,12)(H2,13,14,15)/t2-,3-,4+,5-,6-/m1/s1 |
| InChI Key | RWHOZGRAXYWRNX-VFUOTHLCSA-N |
| Canonical SMILES | C(C1C(C(C(C(O1)OP(=O)(O)O)O)O)O)OP(=O)(O)O |
| CAS | 10139181 |
| Splash | |
| Other Names |
Glucose-1,6-bisphosphate; D-Glucose 1,6-bisphosphate; Glucose 1,6-diphosphate; α-Glucose 1,6-diphosphate |
| Wikipedia | Glucose 1,6-bisphosphate |
| ChEBI | CHEBI:18148 |
| PubChem | 82400 |
| ChemSpider | 74362 |
| KEGG | C00660; C01231 |
| ChemIDPlus | 010139181 |
| HMDb | HMDB03514 |