Systematic / IUPAC Name: (2R,3R,4S,5R,13R,14S,15R,16R)-24-Imino-7,9,11,25,26-pentaoxa-1,17,19,22-tetraaza-8,10-diphosphapentacyclo[18.3.1.12,5 113,16 017,21]hexacosa-18,20,22-triene-3,4,8,10,14,15-hexol 8,10-dioxide
ID: Reference1716
Other Names:
Cyclic adenosine diphosphate ribose;
cADPR
Formula: C15H21N5O13P2
Class: Endogenous Metabolites
Cyclic ADP-ribose mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 2 |
| No. of Spectra | 447 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/2/2014 9:05:53 AM |
| InChI | InChI=1S/C15H21N5O13P2/c16-12-7-13-18-4-19(12)14-10(23)8(21)5(31-14)1-29-34(25,26)33-35(27,28)30-2-6-9(22)11(24)15(32-6)20(13)3-17-7/h3-6,8-11,14-16,21-24H,1-2H2,(H,25,26)(H,27,28)/t5-,6-,8-,9-,10-,11-,14-,15-/m1/s1 |
| InChI Key | BQOHYSXSASDCEA-KEOHHSTQSA-N |
| Canonical SMILES | C1C2C(C(C(O2)N3C=NC4=C3N=CN(C4=N)C5C(C(C(O5)COP(=O)(OP(=O)(O1)O)O)O)O)O)O |
| CAS | 119340533 |
| Splash | |
| Other Names |
Cyclic adenosine diphosphate ribose; cADPR |
| ChemSpider | 21403087 |
| KEGG | C13050 |
| ChEBI | CHEBI:31445 |
| PubChem | 123847 |
| Wikipedia | Cyclic_ADP-ribose |