Systematic / IUPAC Name: 4,5-Diphenyl-1H-imidazole
ID: Reference1742
Other Names:
Imidazole, 4,5-diphenyl-;
1H-Imidazole, 4,5-diphenyl-
Formula: C15H12N2
4,5-Diphenylimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 146 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2014 5:09:52 PM |
| InChI | InChI=1S/C15H12N2/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| InChI Key | CPHGOBGXZQKCKI-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(N=CN2)C3=CC=CC=C3 |
| CAS | 66940 |
| Splash | |
| Other Names |
Imidazole, 4,5-diphenyl-; 1H-Imidazole, 4,5-diphenyl- |
| PubChem | 69588 |
| ChemIDPlus | 000668940 |
| ChEMBL | CHEMBL224554 |
| ChemSpider | 62792 |
| KEGG | D02067 |