Systematic / IUPAC Name: 5-Chloro-1H-indole-2-carboxylic acid
ID: Reference1750
Other Names:
5-Chloroindole-2-carboxylate;
1H-Indole-2-carboxylic acid, 5-chloro-
Formula: C9H6ClNO2
5-Chloroindole-2-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2014 4:50:51 PM |
| InChI | InChI=1S/C9H6ClNO2/c10-6-1-2-7-5(3-6)4-8(11-7)9(12)13/h1-4,11H,(H,12,13) |
| InChI Key | FUQOTYRCMBZFOL-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC2=C(C=C1Cl)C=C(N2)C(=O)O |
| CAS | 10517212 |
| Splash | |
| Other Names |
5-Chloroindole-2-carboxylate; 1H-Indole-2-carboxylic acid, 5-chloro- |
| PubChem | 82693 |
| ChEMBL | CHEMBL23906 |
| ChemIDPlus | 010517212 |
| ChemSpider | 74624 |