Thiodiglycolic acid
1764
Reference
Thiodiglycolic acid Structure
Systematic / IUPAC Name: 2,2'-Sulfanediyldiacetic acid
ID: Reference1764
Other Names:
Thiodiacetic acid;
Acetic acid, thiodi-;
Mercaptodiacetic acid;
(Carboxymethylthio)acetic acid;
Dicarboxydimethyl sulfide
; more
Formula: C4H6O4S
Class: Therapeutics/Prescription Drugs
Spectral Data
Thiodiglycolic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
Available MS Data
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2014 3:50:53 PM |
Identificators
| InChI | InChI=1S/C4H6O4S/c5-3(6)1-9-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
| InChI Key | UVZICZIVKIMRNE-UHFFFAOYSA-N |
| Canonical SMILES | C(C(=O)O)SCC(=O)O |
| CAS | 123933 |
| Splash | |
| Other Names |
Thiodiacetic acid; Acetic acid, thiodi-; Mercaptodiacetic acid; (Carboxymethylthio)acetic acid; Dicarboxydimethyl sulfide; 2-(Carboxymethylthio)acetic acid; 2-[(Carboxymethyl)sulfanyl]acetic acid |
In Other Databases
| KEGG | C14872 |
| ChemIDPlus | 000123933; 042267390 |
| ChEMBL | CHEMBL1570500 |
| PubChem | 31277 |
| ChemSpider | 29017 |
| HMDb | HMDB42032 |
| ChEBI | CHEBI:35012 |
| Wikipedia | Thiodiglycolsäure (DE) |