Systematic / IUPAC Name: (2R)-{[6-O-(β-D-Glucopyranosyl)-β-D-glucopyranosyl]oxy}(phenyl)acetonitrile
ID: Reference1770
Other Names:
(R)-Laenitrile;
D(-)-Mandelonitrile-β-D-gentiobioside;
D-Mandelonitrile-β-D-glucosido-6-β-D-glucoside;
Vitamin B17;
(R)-Amygdalin
Formula: C20H27NO11
Class: Endogenous Metabolites
D(-)-Amygdalin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1783 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 7/21/2025 11:00:00 AM |
| InChI | InChI=1S/C20H27NO11/c21-6-10(9-4-2-1-3-5-9)30-20-18(28)16(26)14(24)12(32-20)8-29-19-17(27)15(25)13(23)11(7-22)31-19/h1-5,10-20,22-28H,7-8H2/t10-,11+,12+,13+,14+,15-,16-,17+,18+,19+,20+/m0/s1 |
| InChI Key | XUCIJNAGGSZNQT-JHSLDZJXSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(C#N)OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)O)O)O)O)O)O |
| CAS | 29883156 |
| Splash | |
| Other Names |
(R)-Laenitrile; D(-)-Mandelonitrile-β-D-gentiobioside; D-Mandelonitrile-β-D-glucosido-6-β-D-glucoside; Vitamin B17; (R)-Amygdalin; (R)-Amygdaloside |
| Wikipedia | Amygdalin |
| ChEBI | CHEBI:17019 |
| KEGG | C08325 |
| PubChem | 656516 |
| ChEMBL | CHEMBL461727 |
| ChemSpider | 570897 |