Systematic / IUPAC Name: 2-Pyridinylacetic acid
ID: Reference181
Other Names:
2-(Pyridin-2-yl)acetic acid;
2-Pyridineacetic acid
Formula: C7H7NO2
Class: Therapeutics/Prescription Drugs
2-Pyridylacetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 173 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/13/2014 3:48:11 PM |
| InChI | InChI=1S/C7H7NO2/c9-7(10)5-6-3-1-2-4-8-6/h1-4H,5H2,(H,9,10) |
| InChI Key | BPSNETAIJADFTO-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=NC(=C1)CC(=O)O |
| CAS | 13115430 |
| Splash | |
| Other Names |
2-(Pyridin-2-yl)acetic acid; 2-Pyridineacetic acid |