Systematic / IUPAC Name: (2Z)-2-Butenedioic acid
ID: Reference1811
Other Names:
Toxilic acid;
Maleinic acid;
Malenic acid;
2-Butenedioic acid (2Z)-;
cis-2-Butenedioic acid
; more
Formula: C4H4O4
Class: Industrial Chemicals
Maleic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/1/2014 1:43:56 PM |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- |
| InChI Key | VZCYOOQTPOCHFL-UPHRSURJSA-N |
| Canonical SMILES | C(=CC(=O)O)C(=O)O |
| CAS | 110167 |
| Splash | |
| Other Names |
Toxilic acid; Maleinic acid; Malenic acid; 2-Butenedioic acid (2Z)-; cis-2-Butenedioic acid; cis-But-2-enedioic acid; cis-Butenedioate; 2-Butenedioate; cis-2-Butenedioate; cis-But-2-enedioate; (2Z)-Butene-2-dioate; (2Z)-Butene-2-dioic acid |
| ChEBI | CHEBI:18300 |
| HMDb | HMDB00176 |
| ChemIDPlus | 000371471; 017013013; 018656252; 020181617; 021465963; 021508407; 026270586; 026270597; 026270600; 026270611 |
| KEGG | C01384; D00621; D00824; D01163; D01944; D03751; D02652; D02730; D02839; D02995 |
| PubChem | 444266; 444972 |
| ChemSpider | 392248 |
| ChEMBL | CHEMBL539648 |
| Wikipedia | Maleic_acid |