Systematic / IUPAC Name: (2S)-2-Hydroxy-3-phenylpropanoic acid
ID: Reference1814
Other Names:
(S)-(-)-2-Hydroxy-3-phenylpropionic acid;
(S)-(-)-3-Phenyllactic acid;
(S)-2-Hydroxy-3-phenylpropanoic acid;
(S)-2-Hydroxy-3-phenylpropionic acid;
3-Phenyl-lactic acid
; more
Formula: C9H10O3
Class: Endogenous Metabolites
L-(-)-3-Phenyllactic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 676 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/7/2015 7:41:27 AM |
| InChI | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m0/s1 |
| InChI Key | VOXXWSYKYCBWHO-QMMMGPOBSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)O)O |
| CAS | 20312361 |
| Splash | |
| Other Names |
(S)-(-)-2-Hydroxy-3-phenylpropionic acid; (S)-(-)-3-Phenyllactic acid; (S)-2-Hydroxy-3-phenylpropanoic acid; (S)-2-Hydroxy-3-phenylpropionic acid; 3-Phenyl-lactic acid; L-2-Hydroxy-3-phenyl-propionic acid; L-3-Phenyllactic acid; α-Hydroxy-β-phenyl-propionic acid |
| ChemSpider | 392566 |
| HMDb | HMDB00563 |
| PubChem | 444718 |
| ChemIDPlus | 057618265 |
| ChEBI | CHEBI:43065 |