Systematic / IUPAC Name: (6aR)-7,11b-Dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol
ID: Reference1818
Other Names: Hematoxylin
Formula: C16H14O6
Class: Endogenous Metabolites
Hematoxylin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 73 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/23/2014 4:15:22 PM |
| InChI | InChI=1S/C16H14O6/c17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h1-4,13,17-21H,5-6H2/t13?,16-/m0/s1 |
| InChI Key | WZUVPPKBWHMQCE-VYIIXAMBSA-N |
| Canonical SMILES | C1C2=CC(=C(C=C2C3C1(COC4=C3C=CC(=C4O)O)O)O)O |
| CAS | 517282 |
| Splash | |
| Other Names | Hematoxylin |
| Wikipedia | Haematoxylin |
| PubChem | 45029742 |
| KEGG | C09931 |
| ChemSpider | 21106443 |