Systematic / IUPAC Name: (S)-[(2R,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol
ID: Reference1828
Other Names: (+)-Quinolin-4-yl(5-vinylquinuclidin-2-yl)methanol
Formula: C19H22N2O
Class: Endogenous Metabolites
Cinchonine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 1220 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 1/8/2015 2:56:49 PM |
| InChI | InChI=1S/C19H22N2O/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17/h2-7,9,13-14,18-19,22H,1,8,10-12H2/t13-,14+,18-,19+/m1/s1 |
| InChI Key | KMPWYEUPVWOPIM-CFGMGRTJSA-N |
| Canonical SMILES | C=CC1CN2CCC1CC2C(C3=CC=NC4=CC=CC=C34)O |
| CAS | 118105 |
| Splash | |
| Other Names | (+)-Quinolin-4-yl(5-vinylquinuclidin-2-yl)methanol |
| Wikipedia | Cinchonine |
| ChemSpider | 21169466 |
| PubChem | 6957610 |