Systematic / IUPAC Name: 1-Methylamino-1-(3,4-methylenedioxyphenyl)propane
ID: Reference1840
Other Names: 1-(1,3-Benzodioxol-5-yl)-N-methyl-propan-1-amine hydrochloride
Formula: C11H15NO2
Class: Drugs of Abuse/Illegal Drugs
1-Methylamino-1-(3,4-methylenedioxyphenyl)propane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 42 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/8/2015 8:12:49 AM |
| InChI | InChI=1S/C11H15NO2.ClH/c1-3-9(12-2)8-4-5-10-11(6-8)14-7-13-10;/h4-6,9,12H,3,7H2,1-2H3;1H |
| InChI Key | OTXZAAXFQKMOTK-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C1=CC2=C(C=C1)OCO2)NC.Cl |
| CAS | |
| Splash | |
| Other Names | 1-(1,3-Benzodioxol-5-yl)-N-methyl-propan-1-amine hydrochloride |
| ChemSpider | 27523957 |
| PubChem | 14647597 |
| Wikipedia | 1-Methylamino-1-(3,4-methylenedioxyphenyl)propane |