Systematic / IUPAC Name: 1-(3,4-dimethylphenyl)-2-(methylamino)propan-1-one
ID: Reference1843
Other Names: 3,4-Dimethylmethcathinone
Formula: C12H17NO
Class: Drugs of Abuse/Illegal Drugs
3,4-DMMC mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 42 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/8/2015 8:31:58 AM |
| InChI | InChI=1S/C12H17NO/c1-8-5-6-11(7-9(8)2)12(14)10(3)13-4/h5-7,10,13H,1-4H3 |
| InChI Key | IBZRXTVDTGVBIS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C=C1)C(=O)C(C)NC)C |
| CAS | 1081772066 |
| Splash | |
| Other Names | 3,4-Dimethylmethcathinone |
| PubChem | 52988261 |
| ChemSpider | 25630192 |
| Wikipedia | 3,4-Dimethylmethcathinone |