Systematic / IUPAC Name: 1-(3-Methoxyphenyl)-N-methyl-2-propanamine
ID: Reference1845
Other Names:
3-MMA;
Benzeneethanamine, 3-methoxy-N,α-dimethyl-
Formula: C11H17NO
3-Methoxymethamphetamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 43 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/8/2015 8:40:40 AM |
| InChI | InChI=1S/C11H17NO/c1-9(12-2)7-10-5-4-6-11(8-10)13-3/h4-6,8-9,12H,7H2,1-3H3 |
| InChI Key | USQWRDRXXKZFDI-UHFFFAOYSA-N |
| Canonical SMILES | CC(CC1=CC(=CC=C1)OC)NC |
| CAS | |
| Splash | |
| Other Names |
3-MMA; Benzeneethanamine, 3-methoxy-N,α-dimethyl- |
| Wikipedia | 3-Methoxymethamphetamine |
| ChemSpider | 115164 |
| PubChem | 130136 |
| ChemIDPlus | 124206662 |