Systematic / IUPAC Name: 4-Methyl-1,3-benzenediamine
ID: Reference1850
Other Names:
4-Methylbenzene-1,3-diamine;
2,4-Toluenediamine;
1,3-Benzenediamine, 4-methyl-;
Toluenediamine;
Toluene-2,4-diamine
; more
Formula: C7H10N2
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
2,4-Diaminotoluene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 163 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 10:53:19 AM |
| InChI | InChI=1S/C7H10N2/c1-5-2-3-6(8)4-7(5)9/h2-4H,8-9H2,1H3 |
| InChI Key | VOZKAJLKRJDJLL-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C=C1)N)N |
| CAS | 95807 |
| Splash | |
| Other Names |
4-Methylbenzene-1,3-diamine; 2,4-Toluenediamine; 1,3-Benzenediamine, 4-methyl-; Toluenediamine; Toluene-2,4-diamine; 2,4-Toluene diamine; m-Toluenediamine; Tolylene-2,4-diamine; m-Tolylenediamine; Toluenediamine, o-; 2,4-Diaminotoluol; 2,4-Tolamine; 4-m-Tolylenediamine; 4-Methyl-m-phenylenediamine; 3-Amino-p-toluidine; 5-Amino-o-toluidine; Fouramine; 2,4-Diamino-1-toluene; 1-Methyl-2,4-phenylenediamine; 1,3-Diamino-4-methylbenzene; 2,4-Diamino-1-methylbenzene; 2,4-Diaminotoluene (2,4-toluene diamine); 4-Methyl-1,3-phenylenediamine; m-Toluylendiamin; 2,4-Diaminotoluen; Diaminotoluene, 2,4-; 4-Methylphenylene-1,3-diamine |
| KEGG | C14401 |
| ChemSpider | 6991 |
| Wikipedia | 2,4-Diaminotoluol (DE); Toluenediamine; 2,4-Diaminotoluene |
| HMDb | HMDB41799 |
| PubChem | 7261 |
| ChEBI | CHEBI:34237 |
| ChEMBL | CHEMBL541230 |
| ChemIDPlus | 000095807; 071111074 |