Systematic / IUPAC Name: 4-(1,2-Dihydroxyethyl)benzene-1,2-diol
ID: Reference187
Other Names:
Dihydroxyphenylethylene glycol;
3,4-Dihydroxyphenylethyleneglycol;
3,4-Dihydroxyphenethyl glycol;
4-(1,2-Dihydroxyethyl)-1,2-benzenediol;
3,4-Dihydroxyphenylethyl glycol
; more
Formula: C8H10O4
Class: Endogenous Metabolites
3,4-Dihydroxyphenylglycol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/14/2014 10:49:30 AM |
| InChI | InChI=1S/C8H10O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8-12H,4H2 |
| InChI Key | MTVWFVDWRVYDOR-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1C(CO)O)O)O |
| CAS | 3343199 |
| Splash | |
| Other Names |
Dihydroxyphenylethylene glycol; 3,4-Dihydroxyphenylethyleneglycol; 3,4-Dihydroxyphenethyl glycol; 4-(1,2-Dihydroxyethyl)-1,2-benzenediol; 3,4-Dihydroxyphenylethyl glycol; (3,4-Dihydroxyphenyl)ethylene glycol; 1-(3,4-Dihydroxyphenyl)-1,2-ethanediol; 1,2-Benzenediol, 4-(1,2-dihydroxyethyl)-; 1-(3,4-Dihydroxyphenyl)ethane-1,2-diol; Phenylglycol, 3,4-dihydroxy-; β,3,4-Trihydroxy phenethyl alcohol; DOPEG |
| ChemIDPlus | 003343199; 028822733 |
| ChEBI | CHEBI:1387 |
| PubChem | 91528 |
| HMDb | HMDB00318 |
| ChemSpider | 82648 |
| KEGG | C05576 |
| Wikipedia | Dihydroxyphenylethylene_glycol |