Systematic / IUPAC Name: 8,8-Dimethyl-3-[(2-propylpentanoyl)oxy]-8-azoniabicyclo[3.2.1]octane
ID: Reference1884
Other Names:
Formula: C17H32NO2 +
Class: Therapeutics/Prescription Drugs
Anisotropine methylbromide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 39 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/16/2015 11:18:45 AM |
| InChI | InChI=1S/C17H32NO2/c1-5-7-13(8-6-2)17(19)20-16-11-14-9-10-15(12-16)18(14,3)4/h13-16H,5-12H2,1-4H3/q+1 |
| InChI Key | XGGHHHBGPSNXFE-UHFFFAOYSA-N |
| Canonical SMILES | CCCC(CCC)C(=O)OC1CC2CCC(C1)[N+]2(C)C |
| CAS | 80502 |
| Splash | |
| Other Names |
| PubChem | 4157 |
| ChemIDPlus | 070642909 |
| Wikipedia | Octatropine methylbromide |
| ChEMBL | CHEMBL368108 |
| ChemSpider | 4014 |