Systematic / IUPAC Name: 2-(Benzylamino)-1-(p-tolyl)propan-1-one
ID: Reference1911
Other Names: 4-MBC
Formula: C17H19NO
Class: Drugs of Abuse/Illegal Drugs
Benzedrone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/16/2016 1:57:35 PM |
| InChI | InChI=1S/C17H19NO/c1-13-8-10-16(11-9-13)17(19)14(2)18-12-15-6-4-3-5-7-15/h3-11,14,18H,12H2,1-2H3 |
| InChI Key | KWHZRPBDEAQYDE-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C(=O)C(C)NCC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 4-MBC |
| ChemSpider | 25630094 |
| Wikipedia | Benzedrone |