Systematic / IUPAC Name: 2-{4-[(3E)-3-(2-Chloro-9H-thioxanthen-9-ylidene)propyl]-1-piperazinyl}ethanol
ID: Reference1932
Other Names: 2-(4-(3-(2-Chloro-9H-thioxanthen-9-ylidene)propyl)piperazin-1-yl)ethanol
Formula: C22H25ClN2OS
Class: Therapeutics/Prescription Drugs
Zuclopenthixol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/14/2015 3:33:32 PM |
| InChI | InChI=1S/C22H25ClN2OS/c23-17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)27-22)5-3-9-24-10-12-25(13-11-24)14-15-26/h1-2,4-8,16,26H,3,9-15H2/b18-5+ |
| InChI Key | WFPIAZLQTJBIFN-BLLMUTORSA-N |
| Canonical SMILES | C1CN(CCN1CCC=C2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)CCO |
| CAS | 53772831 |
| Splash | |
| Other Names | 2-(4-(3-(2-Chloro-9H-thioxanthen-9-ylidene)propyl)piperazin-1-yl)ethanol |
| Wikipedia | Zuclopenthixol |
| ChEMBL | CHEMBL87385 |
| ChemIDPlus | 053772842 |
| PubChem | 5372683 |
| ChemSpider | 4522889 |