Systematic / IUPAC Name: 2-(Methylamino)-1-phenyl-butan-1-one
ID: Reference1944
Other Names:
α-Methylamino-butyrophenone ;
MABP
Formula: C11H15NO
Class: Drugs of Abuse/Illegal Drugs
Buphedrone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 162 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/16/2016 8:24:41 AM |
| InChI | InChI=1S/C11H15NO/c1-3-10(12-2)11(13)9-7-5-4-6-8-9/h4-8,10,12H,3H2,1-2H3 |
| InChI Key | DDPMGIMJSRUULN-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C(=O)C1=CC=CC=C1)NC |
| CAS | 408332796 |
| Splash | |
| Other Names |
α-Methylamino-butyrophenone ; MABP |
| Wikipedia | Buphedrone |
| ChemSpider | 26286946 |
| PubChem | 53249194 |