Systematic / IUPAC Name: 5-(3-Butyryl-2,4,6-trimethylphenyl)-2-[(1E)-N-ethoxypropanimidoyl]-3-hydroxy-2-cyclohexen-1-one
ID: Reference1950
Other Names:
Formula: C24H33NO4
Class: Pesticides/Herbicides
Butroxydim mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/14/2015 1:41:25 PM |
| InChI | InChI=1S/C24H33NO4/c1-7-10-19(26)23-15(5)11-14(4)22(16(23)6)17-12-20(27)24(21(28)13-17)18(8-2)25-29-9-3/h11,17,27H,7-10,12-13H2,1-6H3/b25-18+ |
| InChI Key | ZOGDSYNXUXQGHF-XIEYBQDHSA-N |
| Canonical SMILES | CCCC(=O)C1=C(C=C(C(=C1C)C2CC(=C(C(=O)C2)/C(=N/OCC)/CC)O)C)C |
| CAS | |
| Splash | |
| Other Names |
| KEGG | C18705 |
| ChemSpider | 10469362 |
| ChEMBL | CHEMBL1210086 |