Systematic / IUPAC Name: 3-Hydroxy-2,2-dimethyl-2,3-dihydro-1-benzofuran-7-yl methylcarbamate
ID: Reference1957
Other Names: 3,7-Benzofurandiol, 2,3-dihydro-2,2-dimethyl-, 7-(methylcarbamate)
Formula: C12H15NO4
Class: Pesticides/Herbicides
3-Hydroxycarbofuran mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2105 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/14/2015 11:24:01 AM |
| InChI | InChI=1S/C12H15NO4/c1-12(2)10(14)7-5-4-6-8(9(7)17-12)16-11(15)13-3/h4-6,10,14H,1-3H3,(H,13,15) |
| InChI Key | RHSUJRQZTQNSLL-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C(C2=C(O1)C(=CC=C2)OC(=O)NC)O)C |
| CAS | 16655826 |
| Splash | |
| Other Names | 3,7-Benzofurandiol, 2,3-dihydro-2,2-dimethyl-, 7-(methylcarbamate) |
| ChEMBL | CHEMBL1867082 |
| ChemSpider | 26024 |
| ChemIDPlus | 016655826 |
| PubChem | 27975 |