Systematic / IUPAC Name: 3-(2-Chloro-10H-phenothiazin-10-yl)-N,N-diethyl-1-propanamine
ID: Reference1973
Other Names:
Neuriplege;
2-Chloro-10-(3-diethylaminopropyl)phenothiazine;
Phenothiazine, 2-chloro-10-[3-(diethylamino)propyl]-;
10H-Phenothiazine-10-propanamine, 2-chloro-N,N-diethyl-
Formula: C19H23ClN2S
Class: Therapeutics/Prescription Drugs
Chlorproethazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/13/2015 2:09:15 PM |
| InChI | InChI=1S/C19H23ClN2S/c1-3-21(4-2)12-7-13-22-16-8-5-6-9-18(16)23-19-11-10-15(20)14-17(19)22/h5-6,8-11,14H,3-4,7,12-13H2,1-2H3 |
| InChI Key | DBOUGBAQLIXZLV-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl |
| CAS | 84015 |
| Splash | |
| Other Names |
Neuriplege; 2-Chloro-10-(3-diethylaminopropyl)phenothiazine; Phenothiazine, 2-chloro-10-[3-(diethylamino)propyl]-; 10H-Phenothiazine-10-propanamine, 2-chloro-N,N-diethyl- |
| KEGG | D07308 |
| ChemSpider | 59173 |
| ChEMBL | CHEMBL52125 |
| ChemIDPlus | 000084015 |
| Wikipedia | Chlorproethazine |
| PubChem | 65750 |