Systematic / IUPAC Name: 1-(Diphenylmethyl)-4-[(2Z)-3-phenyl-2-propen-1-yl]piperazine
ID: Reference1982
Other Names: (E)-1-Benzhydryl-4-cinnamylpiperazine
Formula: C26H28N2
Class: Therapeutics/Prescription Drugs
Cinnarizine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/13/2015 12:46:14 PM |
| InChI | InChI=1S/C26H28N2/c1-4-11-23(12-5-1)13-10-18-27-19-21-28(22-20-27)26(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-17,26H,18-22H2/b13-10- |
| InChI Key | DERZBLKQOCDDDZ-RAXLEYEMSA-N |
| Canonical SMILES | C1CN(CCN1CC=CC2=CC=CC=C2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | (E)-1-Benzhydryl-4-cinnamylpiperazine |
| PubChem | 1615336 |
| ChemSpider | 1299022 |
| ChEMBL | CHEMBL1257123 |
| ChemIDPlus | 016699200 |