Systematic / IUPAC Name: 2-[(5H-Dibenzo[a,d][7]annulen-5-ylideneamino)oxy]-N-methylethanamine
ID: Reference2015
Other Names: 5H-Dibenzo[a,d]cyclohepten-5-one, O-[2-(methylamino)ethyl]oxime
Formula: C18H18N2O
Class: Therapeutics/Prescription Drugs
Demexiptiline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/14/2015 9:52:07 AM |
| InChI | InChI=1S/C18H18N2O/c1-19-12-13-21-20-18-16-8-4-2-6-14(16)10-11-15-7-3-5-9-17(15)18/h2-11,19H,12-13H2,1H3 |
| InChI Key | SEDQWOMFMIJKCU-UHFFFAOYSA-N |
| Canonical SMILES | CNCCON=C1C2=CC=CC=C2C=CC3=CC=CC=C31 |
| CAS | 24701517 |
| Splash | |
| Other Names | 5H-Dibenzo[a,d]cyclohepten-5-one, O-[2-(methylamino)ethyl]oxime |
| ChEMBL | CHEMBL2107576 |
| Wikipedia | Demexiptiline |
| PubChem | 28876 |
| ChemSpider | 26858 |
| ChemIDPlus | 024701517 |