Systematic / IUPAC Name: 11-(3-piperazin-1-ylpropyl)benzo[b][1]benzazepine
ID: Reference2017
Other Names: 5H-Dibenz[b,f]azepine, 5-[3-(1-piperazinyl)propyl]-
Formula: C21H25N3
Class: Sports Doping Drugs
Des(2-hydroxyethyl)opipramol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/14/2015 1:07:21 PM |
| InChI | InChI=1S/C21H25N3/c1-3-8-20-18(6-1)10-11-19-7-2-4-9-21(19)24(20)15-5-14-23-16-12-22-13-17-23/h1-4,6-11,22H,5,12-17H2 |
| InChI Key | KDUIIIUHZIHOHE-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1)CCCN2C3=CC=CC=C3C=CC4=CC=CC=C42 |
| CAS | 4346387 |
| Splash | |
| Other Names | 5H-Dibenz[b,f]azepine, 5-[3-(1-piperazinyl)propyl]- |
| PubChem | 85823160 |