Systematic / IUPAC Name: 1,2,3,4,10,14b-Hexahydropyrazino[2,1-a]pyrido[2,3-c][2]benzazepine
ID: Reference2021
Other Names:
Formula: C16H17N3
Class: Therapeutics/Prescription Drugs
Desmethylmirtazapine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/31/2015 11:50:28 AM |
| InChI | InChI=1S/C16H17N3/c1-2-6-14-12(4-1)10-13-5-3-7-18-16(13)19-9-8-17-11-15(14)19/h1-7,15,17H,8-11H2 |
| InChI Key | FGLAMNFOHWVQOH-UHFFFAOYSA-N |
| Canonical SMILES | C1CN2C(CN1)C3=CC=CC=C3CC4=C2N=CC=C4 |
| CAS | 61337686 |
| Splash | |
| Other Names |