Systematic / IUPAC Name: 3-(Dibenzo[b,E]thiepin-11(6H)-ylidene)-8-methyl-8-azabicyclo[3.2.1]octane
ID: Reference2046
Other Names: 8-Azabicyclo(3.2.1)octane, 3-dibenzo(b,E)thiepin-11(6H)-ylidene-8-methyl-
Formula: C22H23NS
Class: Therapeutics/Prescription Drugs
Tropatepine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/20/2015 8:33:23 AM |
| InChI | InChI=1S/C22H23NS/c1-23-17-10-11-18(23)13-16(12-17)22-19-7-3-2-6-15(19)14-24-21-9-5-4-8-20(21)22/h2-9,17-18H,10-14H2,1H3 |
| InChI Key | JOQKFRLFXDPXHX-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2CCC1CC(=C3C4=CC=CC=C4CSC5=CC=CC=C53)C2 |
| CAS | 27574249 |
| Splash | |
| Other Names | 8-Azabicyclo(3.2.1)octane, 3-dibenzo(b,E)thiepin-11(6H)-ylidene-8-methyl- |
| Wikipedia | Tropatepine |
| PubChem | 198068 |
| ChemSpider | 171431 |
| KEGG | D07303 |