Systematic / IUPAC Name: O-(2,6-Dichloro-4-methylphenyl) O,O-dimethyl phosphorothioate
ID: Reference2105
Other Names:
Risolex;
Rizolex;
Toclofos-methyl;
Phosphorothioic acid, O-(2,6-dichloro-4-methylphenyl) O,O-dimethyl ester;
O-2,6-Dichloro-p-tolyl O,O-dimethyl phosphorothioate
; more
Formula: C9H11Cl2O3PS
Class: Pesticides/Herbicides
Tolclofos-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 551 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 7/20/2015 11:08:59 AM |
| InChI | InChI=1S/C9H11Cl2O3PS/c1-6-4-7(10)9(8(11)5-6)14-15(16,12-2)13-3/h4-5H,1-3H3 |
| InChI Key | OBZIQQJJIKNWNO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C(=C1)Cl)OP(=S)(OC)OC)Cl |
| CAS | 57018049 |
| Splash | |
| Other Names |
Risolex; Rizolex; Toclofos-methyl; Phosphorothioic acid, O-(2,6-dichloro-4-methylphenyl) O,O-dimethyl ester; O-2,6-Dichloro-p-tolyl O,O-dimethyl phosphorothioate; O-(2,6-Dichloro-p-tolyl) O,O-dimethyl thiophosphate; O-(2,6-Dichlor-4-methylphenyl)-O,O-dimethylthiophosphat; Phosphorothioic acid, O-(2,6-dichloro-p-tolyl) O,O-dimethyl ester; Basilex |
| ChemSpider | 82767 |
| PubChem | 91664 |
| ChemIDPlus | 057018049; 142618028 |
| ChEMBL | CHEMBL2141416 |
| KEGG | C18407 |
| Wikipedia | Tolclofos-methyl (DE) |