Systematic / IUPAC Name: 7-[2-Hydroxy(di-2-thienyl)acetoxy]-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonane
ID: Reference2111
Other Names:
Formula: C19H22NO4S2 +
Class: Therapeutics/Prescription Drugs
Tiotropium mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 45 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/27/2015 10:15:24 AM |
| InChI | InChI=1S/C19H22NO4S2/c1-20(2)12-9-11(10-13(20)17-16(12)24-17)23-18(21)19(22,14-5-3-7-25-14)15-6-4-8-26-15/h3-8,11-13,16-17,22H,9-10H2,1-2H3/q+1 |
| InChI Key | LERNTVKEWCAPOY-UHFFFAOYSA-N |
| Canonical SMILES | C[N+]1(C2CC(CC1C3C2O3)OC(=O)C(C4=CC=CS4)(C5=CC=CS5)O)C |
| CAS | |
| Splash | |
| Other Names |
| Wikipedia | Tiotropium bromide |
| ChemSpider | 54818 |
| PubChem | 60831 |